C49H51O11P — CID 170444296
dibenzyl [(2R,3S,4R,6R)-5-hydroxy-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl] phosphate (PubChem CID 170444296) has the molecular formula C49H51O11P and a molecular weight of 846.91 g/mol. Its IUPAC name is dibenzyl [(2R,3S,4R,6R)-5-hydroxy-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl] phosphate.
| Compound Name | dibenzyl [(2R,3S,4R,6R)-5-hydroxy-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 170444296 |
| Molecular Formula | C49H51O11P |
| Molecular Weight | 846.91 g/mol |
| Exact Mass | 846.32 |
| IUPAC Name | dibenzyl [(2R,3S,4R,6R)-5-hydroxy-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)O[C@H]1O[C@H]([C@@H](CO)OCc2ccccc2)C(O)(OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H51O11P/c50-31-44(53-32-38-19-7-1-8-20-38)46-49(51,56-35-41-25-13-4-14-26-41)47(55-34-40-23-11-3-12-24-40)45(54-33-39-21-9-2-10-22-39)48(59-46)60-61(52,57-36-42-27-15-5-16-28-42)58-37-43-29-17-6-18-30-43/h1-30,44-48,50-51H,31-37H2/t44-,45+,46-,47-,48-,49?/m1/s1 |
| InChIKey | MUOBSXOJPKWKQF-UJZITZCGSA-N |
| XLogP | 8.92 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.91 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|