C20H24FO8P — CID 56840465
dibenzyl [(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 56840465) has the molecular formula C20H24FO8P and a molecular weight of 442.38 g/mol. Its IUPAC name is dibenzyl [(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | dibenzyl [(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 56840465 |
| Molecular Formula | C20H24FO8P |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | dibenzyl [(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1F |
| InChI | InChI=1S/C20H24FO8P/c21-17-19(24)18(23)16(11-22)28-20(17)29-30(25,26-12-14-7-3-1-4-8-14)27-13-15-9-5-2-6-10-15/h1-10,16-20,22-24H,11-13H2/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | JEQMDTKAEMUZFP-WAPOTWQKSA-N |
| XLogP | 2.32 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|