C18H26FO12PS — CID 132608779
[(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methyl hydrogen phosphate (PubChem CID 132608779) has the molecular formula C18H26FO12PS and a molecular weight of 516.43 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 132608779 |
| Molecular Formula | C18H26FO12PS |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methyl hydrogen phosphate |
| SMILES | O=P(O)(OC[C@H]1O[C@H](Sc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C18H26FO12PS/c19-11-14(23)12(21)9(6-20)29-17(11)31-32(26,27)28-7-10-13(22)15(24)16(25)18(30-10)33-8-4-2-1-3-5-8/h1-5,9-18,20-25H,6-7H2,(H,26,27)/t9-,10-,11+,12-,13-,14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | JBSHZFSBSZXOBZ-VIVGPOPYSA-N |
| XLogP | -1.50 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|