C18H26NNaO16P — CID 131864701
CID 131864701 (PubChem CID 131864701) has the molecular formula C18H26NNaO16P and a molecular weight of 566.36 g/mol.
| Compound Name | CID 131864701 |
|---|---|
| PubChem CID | 131864701 |
| Molecular Formula | C18H26NNaO16P |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(OC2OC(COP(=O)(O)OC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)cc1.[Na] |
| InChI | InChI=1S/C18H26NO16P.Na/c20-5-9-11(21)13(23)16(26)18(33-9)35-36(29,30)31-6-10-12(22)14(24)15(25)17(34-10)32-8-3-1-7(2-4-8)19(27)28;/h1-4,9-18,20-26H,5-6H2,(H,29,30); |
| InChIKey | IDZAUULRQLIPGI-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 268.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|