C13H17NO8 — CID 101046128
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol (PubChem CID 101046128) has the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol |
|---|---|
| PubChem CID | 101046128 |
| Molecular Formula | C13H17NO8 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](Oc2ccc([N+](=O)[O-])cc2)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C13H17NO8/c1-20-12-10(16)9(6-15)22-13(11(12)17)21-8-4-2-7(3-5-8)14(18)19/h2-5,9-13,15-17H,6H2,1H3/t9-,10-,11-,12+,13-/m1/s1 |
| InChIKey | HNKDHAGVHBOYLY-NJMOYASZSA-N |
| XLogP | -0.57 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|