C19H31NO8Si — CID 54150328
(2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol (PubChem CID 54150328) has the molecular formula C19H31NO8Si and a molecular weight of 429.54 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol |
|---|---|
| PubChem CID | 54150328 |
| Molecular Formula | C19H31NO8Si |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6-(4-nitrophenoxy)oxane-3,5-diol |
| SMILES | CO[C@H]1[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](Oc2ccc([N+](=O)[O-])cc2)[C@@H]1O |
| InChI | InChI=1S/C19H31NO8Si/c1-19(2,3)29(5,6)26-11-14-15(21)17(25-4)16(22)18(28-14)27-13-9-7-12(8-10-13)20(23)24/h7-10,14-18,21-22H,11H2,1-6H3/t14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | OHGREQHOVPGNAG-MDMSPXHWSA-N |
| XLogP | 2.46 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|