C19H32NO8PSi — CID 163608363
[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methoxy-methylphosphinic acid (PubChem CID 163608363) has the molecular formula C19H32NO8PSi and a molecular weight of 461.52 g/mol. Its IUPAC name is [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 163608363 |
| Molecular Formula | C19H32NO8PSi |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methoxy-methylphosphinic acid |
| SMILES | CC1[C@@H](Oc2ccc([N+](=O)[O-])cc2)O[C@H](COP(C)(=O)O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32NO8PSi/c1-13-17(28-30(6,7)19(2,3)4)16(12-25-29(5,23)24)27-18(13)26-15-10-8-14(9-11-15)20(21)22/h8-11,13,16-18H,12H2,1-7H3,(H,23,24)/t13?,16-,17+,18+/m1/s1 |
| InChIKey | PWMAZZDYTFFLKU-LLHIWASSSA-N |
| XLogP | 4.56 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|