C22H36NO8PSi — CID 174063684
[(2R,3S,4R,5S,6R)-2-[(E)-2-diethoxyphosphorylethenyl]-4,5-dimethyl-6-(4-nitrophenoxy)oxan-3-yl]oxy-trimethylsilane (PubChem CID 174063684) has the molecular formula C22H36NO8PSi and a molecular weight of 501.59 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-2-[(E)-2-diethoxyphosphorylethenyl]-4,5-dimethyl-6-(4-nitrophenoxy)oxan-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3S,4R,5S,6R)-2-[(E)-2-diethoxyphosphorylethenyl]-4,5-dimethyl-6-(4-nitrophenoxy)oxan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 174063684 |
| Molecular Formula | C22H36NO8PSi |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-2-[(E)-2-diethoxyphosphorylethenyl]-4,5-dimethyl-6-(4-nitrophenoxy)oxan-3-yl]oxy-trimethylsilane |
| SMILES | CCOP(=O)(/C=C/[C@H]1O[C@H](Oc2ccc([N+](=O)[O-])cc2)[C@@H](C)[C@@H](C)[C@@H]1O[Si](C)(C)C)OCC |
| InChI | InChI=1S/C22H36NO8PSi/c1-8-27-32(26,28-9-2)15-14-20-21(31-33(5,6)7)16(3)17(4)22(30-20)29-19-12-10-18(11-13-19)23(24)25/h10-17,20-22H,8-9H2,1-7H3/b15-14+/t16-,17+,20-,21+,22+/m1/s1 |
| InChIKey | DGKPVNHYTDXBMZ-ATZSIONYSA-N |
| XLogP | 5.97 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|