C18H29NO6Si — CID 163718738
[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methanol (PubChem CID 163718738) has the molecular formula C18H29NO6Si and a molecular weight of 383.52 g/mol. Its IUPAC name is [(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methanol.
| Compound Name | [(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 163718738 |
| Molecular Formula | C18H29NO6Si |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(4-nitrophenoxy)oxolan-2-yl]methanol |
| SMILES | C[C@H]1C(Oc2ccc([N+](=O)[O-])cc2)OC(CO)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO6Si/c1-12-16(25-26(5,6)18(2,3)4)15(11-20)24-17(12)23-14-9-7-13(8-10-14)19(21)22/h7-10,12,15-17,20H,11H2,1-6H3/t12-,15?,16+,17?/m1/s1 |
| InChIKey | QDAGPXRTRHXPNJ-XBOHUIDSSA-N |
| XLogP | 3.72 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|