C15H21NO8 — CID 70343859
[(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(4-nitrophenoxy)oxan-2-yl]methanol (PubChem CID 70343859) has the molecular formula C15H21NO8 and a molecular weight of 343.33 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(4-nitrophenoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(4-nitrophenoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 70343859 |
| Molecular Formula | C15H21NO8 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-6-(4-nitrophenoxy)oxan-2-yl]methanol |
| SMILES | CO[C@H]1[C@@H](OC)[C@@H](CO)O[C@H](Oc2ccc([N+](=O)[O-])cc2)[C@@H]1OC |
| InChI | InChI=1S/C15H21NO8/c1-20-12-11(8-17)24-15(14(22-3)13(12)21-2)23-10-6-4-9(5-7-10)16(18)19/h4-7,11-15,17H,8H2,1-3H3/t11-,12+,13+,14-,15+/m1/s1 |
| InChIKey | BIYWQFBOKMKRMC-FQKPHLNHSA-N |
| XLogP | 0.74 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|