C27H29NO7 — CID 135024884
[5-methyl-6-(4-nitrophenoxy)-3,4-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 135024884) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is [5-methyl-6-(4-nitrophenoxy)-3,4-bis(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [5-methyl-6-(4-nitrophenoxy)-3,4-bis(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 135024884 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [5-methyl-6-(4-nitrophenoxy)-3,4-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CC1C(Oc2ccc([N+](=O)[O-])cc2)OC(CO)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C27H29NO7/c1-19-25(32-17-20-8-4-2-5-9-20)26(33-18-21-10-6-3-7-11-21)24(16-29)35-27(19)34-23-14-12-22(13-15-23)28(30)31/h2-15,19,24-27,29H,16-18H2,1H3 |
| InChIKey | WSJCOPHTVHFGNJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|