C29H31NO8 — CID 14411549
(3aS,4R,6S,7R,7aS)-2,2-dimethyl-6-(4-nitrophenoxy)-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 14411549) has the molecular formula C29H31NO8 and a molecular weight of 521.57 g/mol. Its IUPAC name is (3aS,4R,6S,7R,7aS)-2,2-dimethyl-6-(4-nitrophenoxy)-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aS,4R,6S,7R,7aS)-2,2-dimethyl-6-(4-nitrophenoxy)-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 14411549 |
| Molecular Formula | C29H31NO8 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | (3aS,4R,6S,7R,7aS)-2,2-dimethyl-6-(4-nitrophenoxy)-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COCc1ccccc1)O[C@@H](Oc1ccc([N+](=O)[O-])cc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C29H31NO8/c1-29(2)37-25-24(19-33-17-20-9-5-3-6-10-20)36-28(35-23-15-13-22(14-16-23)30(31)32)27(26(25)38-29)34-18-21-11-7-4-8-12-21/h3-16,24-28H,17-19H2,1-2H3/t24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | NOKAFVSCWKHBED-QBROEMLDSA-N |
| XLogP | 5.02 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|