C26H27NO8 — CID 134865054
(3R,6S)-6-(4-nitrophenoxy)-5-phenylmethoxy-2-(phenylmethoxymethyl)oxane-3,4-diol (PubChem CID 134865054) has the molecular formula C26H27NO8 and a molecular weight of 481.50 g/mol. Its IUPAC name is (3R,6S)-6-(4-nitrophenoxy)-5-phenylmethoxy-2-(phenylmethoxymethyl)oxane-3,4-diol.
| Compound Name | (3R,6S)-6-(4-nitrophenoxy)-5-phenylmethoxy-2-(phenylmethoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 134865054 |
| Molecular Formula | C26H27NO8 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (3R,6S)-6-(4-nitrophenoxy)-5-phenylmethoxy-2-(phenylmethoxymethyl)oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2OC(COCc3ccccc3)[C@H](O)C(O)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO8/c28-23-22(17-32-15-18-7-3-1-4-8-18)35-26(34-21-13-11-20(12-14-21)27(30)31)25(24(23)29)33-16-19-9-5-2-6-10-19/h1-14,22-26,28-29H,15-17H2/t22?,23-,24?,25?,26+/m0/s1 |
| InChIKey | IBGMPOLIWHKGRK-ZVJRPXOFSA-N |
| XLogP | 3.22 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|