C45H41NO8 — CID 20676521
(2R,3S,4S,5R,6S)-6-(4-nitrophenoxy)-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol (PubChem CID 20676521) has the molecular formula C45H41NO8 and a molecular weight of 723.82 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-6-(4-nitrophenoxy)-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,4S,5R,6S)-6-(4-nitrophenoxy)-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 20676521 |
| Molecular Formula | C45H41NO8 |
| Molecular Weight | 723.82 g/mol |
| Exact Mass | 723.28 |
| IUPAC Name | (2R,3S,4S,5R,6S)-6-(4-nitrophenoxy)-4,5-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-ol |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H](O)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C45H41NO8/c47-41-40(32-52-45(35-20-10-3-11-21-35,36-22-12-4-13-23-36)37-24-14-5-15-25-37)54-44(53-39-28-26-38(27-29-39)46(48)49)43(51-31-34-18-8-2-9-19-34)42(41)50-30-33-16-6-1-7-17-33/h1-29,40-44,47H,30-32H2/t40-,41+,42+,43-,44-/m1/s1 |
| InChIKey | ZLNJSBBYIXPUEC-NXSMLEGGSA-N |
| XLogP | 8.24 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.82 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|