C33H31NO9 — CID 11261767
[(2S,3R,4S,5R,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl] 4-nitrobenzoate (PubChem CID 11261767) has the molecular formula C33H31NO9 and a molecular weight of 585.61 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11261767 |
| Molecular Formula | C33H31NO9 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,5-dihydroxy-2-methoxy-6-(trityloxymethyl)oxan-4-yl] 4-nitrobenzoate |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1O |
| InChI | InChI=1S/C33H31NO9/c1-40-32-29(36)30(43-31(37)22-17-19-26(20-18-22)34(38)39)28(35)27(42-32)21-41-33(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,27-30,32,35-36H,21H2,1H3/t27-,28-,29-,30+,32+/m1/s1 |
| InChIKey | MWYMEMFGVZEJBV-LPSMZVTISA-N |
| XLogP | 4.22 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|