C35H35NO7 — CID 130378412
[(2R,3S,4R)-4-butoxy-2-(trityloxymethyl)oxolan-3-yl] 4-nitrobenzoate (PubChem CID 130378412) has the molecular formula C35H35NO7 and a molecular weight of 581.67 g/mol. Its IUPAC name is [(2R,3S,4R)-4-butoxy-2-(trityloxymethyl)oxolan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3S,4R)-4-butoxy-2-(trityloxymethyl)oxolan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 130378412 |
| Molecular Formula | C35H35NO7 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | [(2R,3S,4R)-4-butoxy-2-(trityloxymethyl)oxolan-3-yl] 4-nitrobenzoate |
| SMILES | CCCCO[C@@H]1CO[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H35NO7/c1-2-3-23-40-31-24-41-32(33(31)43-34(37)26-19-21-30(22-20-26)36(38)39)25-42-35(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,31-33H,2-3,23-25H2,1H3/t31-,32-,33+/m1/s1 |
| InChIKey | BXWBBWPXTNXLLH-SLGZMBILSA-N |
| XLogP | 6.71 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|