C22H31NO10 — CID 126590873
[(3S,4aS,5R,8S,8aR)-5-butoxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-nitrobenzoate (PubChem CID 126590873) has the molecular formula C22H31NO10 and a molecular weight of 469.49 g/mol. Its IUPAC name is [(3S,4aS,5R,8S,8aR)-5-butoxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-nitrobenzoate.
| Compound Name | [(3S,4aS,5R,8S,8aR)-5-butoxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126590873 |
| Molecular Formula | C22H31NO10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | [(3S,4aS,5R,8S,8aR)-5-butoxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-nitrobenzoate |
| SMILES | CCCCO[C@@H]1OC[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H]2OC(C)(OC)[C@@](C)(OC)O[C@H]12 |
| InChI | InChI=1S/C22H31NO10/c1-6-7-12-29-20-18-17(32-21(2,27-4)22(3,28-5)33-18)16(13-30-20)31-19(24)14-8-10-15(11-9-14)23(25)26/h8-11,16-18,20H,6-7,12-13H2,1-5H3/t16-,17+,18-,20+,21?,22-/m0/s1 |
| InChIKey | QBBRGHNZOXPCRE-BBJYWWPISA-N |
| XLogP | 2.80 |
| TPSA | 124.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|