C17H20FN7O6 — CID 168793328
[(2R,3S,4R,5S)-5-azido-2-(azidomethyl)-6-butoxy-4-fluorooxan-3-yl] 4-nitrobenzoate (PubChem CID 168793328) has the molecular formula C17H20FN7O6 and a molecular weight of 437.39 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-azido-2-(azidomethyl)-6-butoxy-4-fluorooxan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3S,4R,5S)-5-azido-2-(azidomethyl)-6-butoxy-4-fluorooxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 168793328 |
| Molecular Formula | C17H20FN7O6 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [(2R,3S,4R,5S)-5-azido-2-(azidomethyl)-6-butoxy-4-fluorooxan-3-yl] 4-nitrobenzoate |
| SMILES | CCCCOC1O[C@H](CN=[N+]=[N-])[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H](F)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C17H20FN7O6/c1-2-3-8-29-17-14(22-24-20)13(18)15(12(30-17)9-21-23-19)31-16(26)10-4-6-11(7-5-10)25(27)28/h4-7,12-15,17H,2-3,8-9H2,1H3/t12-,13-,14-,15+,17?/m1/s1 |
| InChIKey | AEUJFXWLRCMJIO-WQYWAISESA-N |
| XLogP | 3.99 |
| TPSA | 185.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|