C16H16N4O7 — CID 167395621
[(1S,3R,4R)-3-(2-azidoacetyl)-4-methoxycarbonylcyclopentyl] 4-nitrobenzoate (PubChem CID 167395621) has the molecular formula C16H16N4O7 and a molecular weight of 376.33 g/mol. Its IUPAC name is [(1S,3R,4R)-3-(2-azidoacetyl)-4-methoxycarbonylcyclopentyl] 4-nitrobenzoate.
| Compound Name | [(1S,3R,4R)-3-(2-azidoacetyl)-4-methoxycarbonylcyclopentyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 167395621 |
| Molecular Formula | C16H16N4O7 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [(1S,3R,4R)-3-(2-azidoacetyl)-4-methoxycarbonylcyclopentyl] 4-nitrobenzoate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C[C@H]1C(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C16H16N4O7/c1-26-16(23)13-7-11(6-12(13)14(21)8-18-19-17)27-15(22)9-2-4-10(5-3-9)20(24)25/h2-5,11-13H,6-8H2,1H3/t11-,12+,13+/m0/s1 |
| InChIKey | KWZFXKDVFONBDL-YNEHKIRRSA-N |
| XLogP | 2.20 |
| TPSA | 161.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|