C23H24N2O8 — CID 146636369
[3-methoxycarbonyl-5-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate (PubChem CID 146636369) has the molecular formula C23H24N2O8 and a molecular weight of 456.45 g/mol. Its IUPAC name is [3-methoxycarbonyl-5-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate.
| Compound Name | [3-methoxycarbonyl-5-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 146636369 |
| Molecular Formula | C23H24N2O8 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [3-methoxycarbonyl-5-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate |
| SMILES | COC(=O)C1CC(NC(=O)OCc2ccccc2)CC(OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C23H24N2O8/c1-31-21(26)17-11-18(24-23(28)32-14-15-5-3-2-4-6-15)13-20(12-17)33-22(27)16-7-9-19(10-8-16)25(29)30/h2-10,17-18,20H,11-14H2,1H3,(H,24,28) |
| InChIKey | FKZOFOXLIJXCRP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|