C21H21NO7 — CID 178033060
benzyl 3-(4-nitrophenoxy)carbonyloxycyclohexane-1-carboxylate (PubChem CID 178033060) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is benzyl 3-(4-nitrophenoxy)carbonyloxycyclohexane-1-carboxylate.
| Compound Name | benzyl 3-(4-nitrophenoxy)carbonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 178033060 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | benzyl 3-(4-nitrophenoxy)carbonyloxycyclohexane-1-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)OC1CCCC(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H21NO7/c23-20(27-14-15-5-2-1-3-6-15)16-7-4-8-19(13-16)29-21(24)28-18-11-9-17(10-12-18)22(25)26/h1-3,5-6,9-12,16,19H,4,7-8,13-14H2 |
| InChIKey | VVMKNCRTNZVZFU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|