C12H14N2O5 — CID 163959997
[(1R,2R)-2-aminocyclopentyl] (4-nitrophenyl) carbonate (PubChem CID 163959997) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is [(1R,2R)-2-aminocyclopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [(1R,2R)-2-aminocyclopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 163959997 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [(1R,2R)-2-aminocyclopentyl] (4-nitrophenyl) carbonate |
| SMILES | N[C@@H]1CCC[C@H]1OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N2O5/c13-10-2-1-3-11(10)19-12(15)18-9-6-4-8(5-7-9)14(16)17/h4-7,10-11H,1-3,13H2/t10-,11-/m1/s1 |
| InChIKey | SGQDNMVBWQTMSK-GHMZBOCLSA-N |
| XLogP | 1.99 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|