C19H20N2O5S2 — CID 155484727
(4-nitrophenyl) [(1S,2S)-2-(pyridin-2-yldisulfanyl)cycloheptyl] carbonate (PubChem CID 155484727) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is (4-nitrophenyl) [(1S,2S)-2-(pyridin-2-yldisulfanyl)cycloheptyl] carbonate.
| Compound Name | (4-nitrophenyl) [(1S,2S)-2-(pyridin-2-yldisulfanyl)cycloheptyl] carbonate |
|---|---|
| PubChem CID | 155484727 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (4-nitrophenyl) [(1S,2S)-2-(pyridin-2-yldisulfanyl)cycloheptyl] carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)O[C@H]1CCCCC[C@@H]1SSc1ccccn1 |
| InChI | InChI=1S/C19H20N2O5S2/c22-19(25-15-11-9-14(10-12-15)21(23)24)26-16-6-2-1-3-7-17(16)27-28-18-8-4-5-13-20-18/h4-5,8-13,16-17H,1-3,6-7H2/t16-,17-/m0/s1 |
| InChIKey | QNYLWNCKHSHYDK-IRXDYDNUSA-N |
| XLogP | 5.65 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|