C16H14N2O6S2 — CID 155484814
(4-nitrophenyl) [(3R,4R)-4-(pyridin-2-yldisulfanyl)oxolan-3-yl] carbonate (PubChem CID 155484814) has the molecular formula C16H14N2O6S2 and a molecular weight of 394.43 g/mol. Its IUPAC name is (4-nitrophenyl) [(3R,4R)-4-(pyridin-2-yldisulfanyl)oxolan-3-yl] carbonate.
| Compound Name | (4-nitrophenyl) [(3R,4R)-4-(pyridin-2-yldisulfanyl)oxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 155484814 |
| Molecular Formula | C16H14N2O6S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (4-nitrophenyl) [(3R,4R)-4-(pyridin-2-yldisulfanyl)oxolan-3-yl] carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)O[C@@H]1COC[C@H]1SSc1ccccn1 |
| InChI | InChI=1S/C16H14N2O6S2/c19-16(23-12-6-4-11(5-7-12)18(20)21)24-13-9-22-10-14(13)25-26-15-3-1-2-8-17-15/h1-8,13-14H,9-10H2/t13-,14-/m1/s1 |
| InChIKey | ODKDXSRCJGBIAJ-ZIAGYGMSSA-N |
| XLogP | 3.71 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|