C14H15NO7 — CID 75586931
3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyran-4-yl (4-nitrophenyl) carbonate (PubChem CID 75586931) has the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. Its IUPAC name is 3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyran-4-yl (4-nitrophenyl) carbonate.
| Compound Name | 3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyran-4-yl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 75586931 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyran-4-yl (4-nitrophenyl) carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)OC1CCOC2COCC21 |
| InChI | InChI=1S/C14H15NO7/c16-14(21-10-3-1-9(2-4-10)15(17)18)22-12-5-6-20-13-8-19-7-11(12)13/h1-4,11-13H,5-8H2 |
| InChIKey | UTFCAEJFQZZFDN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|