C15H17NO7 — CID 118521052
(3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) (4-nitrophenyl) carbonate (PubChem CID 118521052) has the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. Its IUPAC name is (3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) (4-nitrophenyl) carbonate.
| Compound Name | (3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 118521052 |
| Molecular Formula | C15H17NO7 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-5-yl) (4-nitrophenyl) carbonate |
| SMILES | CC1COC2OCC(OC(=O)Oc3ccc([N+](=O)[O-])cc3)CC12 |
| InChI | InChI=1S/C15H17NO7/c1-9-7-20-14-13(9)6-12(8-21-14)23-15(17)22-11-4-2-10(3-5-11)16(18)19/h2-5,9,12-14H,6-8H2,1H3 |
| InChIKey | QOTMZOKSAROOPJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|