C19H23NO7 — CID 73292703
[(3aS,4aR,8S,8aR,8bR)-6,6-dimethyl-2,3a,4a,5,7,8,8a,8b-octahydro-1H-furo[2,3-b][1]benzofuran-8-yl] (4-nitrophenyl) carbonate (PubChem CID 73292703) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is [(3aS,4aR,8S,8aR,8bR)-6,6-dimethyl-2,3a,4a,5,7,8,8a,8b-octahydro-1H-furo[2,3-b][1]benzofuran-8-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(3aS,4aR,8S,8aR,8bR)-6,6-dimethyl-2,3a,4a,5,7,8,8a,8b-octahydro-1H-furo[2,3-b][1]benzofuran-8-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 73292703 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [(3aS,4aR,8S,8aR,8bR)-6,6-dimethyl-2,3a,4a,5,7,8,8a,8b-octahydro-1H-furo[2,3-b][1]benzofuran-8-yl] (4-nitrophenyl) carbonate |
| SMILES | CC1(C)C[C@H](OC(=O)Oc2ccc([N+](=O)[O-])cc2)[C@@H]2[C@H]3CCO[C@H]3O[C@@H]2C1 |
| InChI | InChI=1S/C19H23NO7/c1-19(2)9-14-16(13-7-8-24-17(13)26-14)15(10-19)27-18(21)25-12-5-3-11(4-6-12)20(22)23/h3-6,13-17H,7-10H2,1-2H3/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | BEFBXUCSBBLHBL-UUAJXVIYSA-N |
| XLogP | 3.68 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|