C13H12N4O7 — CID 122212294
[(3R,3aS,4R,6aR)-3-azido-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate (PubChem CID 122212294) has the molecular formula C13H12N4O7 and a molecular weight of 336.26 g/mol. Its IUPAC name is [(3R,3aS,4R,6aR)-3-azido-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(3R,3aS,4R,6aR)-3-azido-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 122212294 |
| Molecular Formula | C13H12N4O7 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [(3R,3aS,4R,6aR)-3-azido-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate |
| SMILES | [N-]=[N+]=N[C@H]1CO[C@@H]2OC[C@H](OC(=O)Oc3ccc([N+](=O)[O-])cc3)[C@@H]21 |
| InChI | InChI=1S/C13H12N4O7/c14-16-15-9-5-21-12-11(9)10(6-22-12)24-13(18)23-8-3-1-7(2-4-8)17(19)20/h1-4,9-12H,5-6H2/t9-,10-,11-,12+/m0/s1 |
| InChIKey | UIIUXDGZXBNERB-FIQHERPVSA-N |
| XLogP | 2.16 |
| TPSA | 145.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|