C13H13N5O7 — CID 6613471
(4-nitrophenyl) N-(2-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl)carbamate (PubChem CID 6613471) has the molecular formula C13H13N5O7 and a molecular weight of 351.28 g/mol. Its IUPAC name is (4-nitrophenyl) N-(2-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl)carbamate.
| Compound Name | (4-nitrophenyl) N-(2-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl)carbamate |
|---|---|
| PubChem CID | 6613471 |
| Molecular Formula | C13H13N5O7 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (4-nitrophenyl) N-(2-azido-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl)carbamate |
| SMILES | [N-]=[N+]=NC1C2COC(O2)C(NC(=O)Oc2ccc([N+](=O)[O-])cc2)C1O |
| InChI | InChI=1S/C13H13N5O7/c14-17-16-9-8-5-23-12(25-8)10(11(9)19)15-13(20)24-7-3-1-6(2-4-7)18(21)22/h1-4,8-12,19H,5H2,(H,15,20) |
| InChIKey | PBWDIPUROKDAKJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 168.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|