C20H19N5O8S — CID 11973568
(1R,2S,3R,4S,5R)-4-azido-3-(2,4-dinitrophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxy]-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 11973568) has the molecular formula C20H19N5O8S and a molecular weight of 489.47 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R)-4-azido-3-(2,4-dinitrophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxy]-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,2S,3R,4S,5R)-4-azido-3-(2,4-dinitrophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxy]-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11973568 |
| Molecular Formula | C20H19N5O8S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (1R,2S,3R,4S,5R)-4-azido-3-(2,4-dinitrophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxy]-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | COc1ccc(CO[C@@H]2[C@H](Sc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])[C@@H](N=[N+]=[N-])[C@@H]3OC[C@H]2O3)cc1 |
| InChI | InChI=1S/C20H19N5O8S/c1-30-13-5-2-11(3-6-13)9-31-18-15-10-32-20(33-15)17(22-23-21)19(18)34-16-7-4-12(24(26)27)8-14(16)25(28)29/h2-8,15,17-20H,9-10H2,1H3/t15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | GYWRFBPNPQJPMJ-XIKSMUEASA-N |
| XLogP | 3.99 |
| TPSA | 171.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|