C13H13ClN2O4S — CID 91694395
2-chloro-3-(2,4-dinitrophenyl)sulfanylbicyclo[2.2.1]heptane (PubChem CID 91694395) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-chloro-3-(2,4-dinitrophenyl)sulfanylbicyclo[2.2.1]heptane.
| Compound Name | 2-chloro-3-(2,4-dinitrophenyl)sulfanylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 91694395 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-chloro-3-(2,4-dinitrophenyl)sulfanylbicyclo[2.2.1]heptane |
| SMILES | O=[N+]([O-])c1ccc(SC2C3CCC(C3)C2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13ClN2O4S/c14-12-7-1-2-8(5-7)13(12)21-11-4-3-9(15(17)18)6-10(11)16(19)20/h3-4,6-8,12-13H,1-2,5H2 |
| InChIKey | JFVNTJRMFWWEKC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|