C18H20N2O10S — CID 102229242
[(1R,2S,4R,5R)-2,5-diacetyloxy-4-(2,4-dinitrophenyl)sulfanylcyclohexyl] acetate (PubChem CID 102229242) has the molecular formula C18H20N2O10S and a molecular weight of 456.43 g/mol. Its IUPAC name is [(1R,2S,4R,5R)-2,5-diacetyloxy-4-(2,4-dinitrophenyl)sulfanylcyclohexyl] acetate.
| Compound Name | [(1R,2S,4R,5R)-2,5-diacetyloxy-4-(2,4-dinitrophenyl)sulfanylcyclohexyl] acetate |
|---|---|
| PubChem CID | 102229242 |
| Molecular Formula | C18H20N2O10S |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [(1R,2S,4R,5R)-2,5-diacetyloxy-4-(2,4-dinitrophenyl)sulfanylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[C@H](OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H20N2O10S/c1-9(21)28-14-7-16(30-11(3)23)18(8-15(14)29-10(2)22)31-17-5-4-12(19(24)25)6-13(17)20(26)27/h4-6,14-16,18H,7-8H2,1-3H3/t14-,15+,16-,18-/m1/s1 |
| InChIKey | YHMRMXPJYZQMTR-KYHPRHEASA-N |
| XLogP | 2.55 |
| TPSA | 165.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|