C15H15FN2O10 — CID 172882906
[(3R,4S,5S,6R)-4-acetyloxy-6-(2,4-dinitrophenoxy)-5-fluorooxan-3-yl] acetate (PubChem CID 172882906) has the molecular formula C15H15FN2O10 and a molecular weight of 402.29 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4-acetyloxy-6-(2,4-dinitrophenoxy)-5-fluorooxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6R)-4-acetyloxy-6-(2,4-dinitrophenoxy)-5-fluorooxan-3-yl] acetate |
|---|---|
| PubChem CID | 172882906 |
| Molecular Formula | C15H15FN2O10 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [(3R,4S,5S,6R)-4-acetyloxy-6-(2,4-dinitrophenoxy)-5-fluorooxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](F)[C@@H](Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H15FN2O10/c1-7(19)26-12-6-25-15(13(16)14(12)27-8(2)20)28-11-4-3-9(17(21)22)5-10(11)18(23)24/h3-5,12-15H,6H2,1-2H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | SBDPBHVZUYKNFP-CBBWQLFWSA-N |
| XLogP | 1.44 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|