C16H16ClNO9 — CID 71182431
[(3S,5S,6S)-4-acetyloxy-3-(2-chloro-4-nitrophenoxy)-2,7-dioxabicyclo[4.2.0]octan-5-yl] acetate (PubChem CID 71182431) has the molecular formula C16H16ClNO9 and a molecular weight of 401.76 g/mol. Its IUPAC name is [(3S,5S,6S)-4-acetyloxy-3-(2-chloro-4-nitrophenoxy)-2,7-dioxabicyclo[4.2.0]octan-5-yl] acetate.
| Compound Name | [(3S,5S,6S)-4-acetyloxy-3-(2-chloro-4-nitrophenoxy)-2,7-dioxabicyclo[4.2.0]octan-5-yl] acetate |
|---|---|
| PubChem CID | 71182431 |
| Molecular Formula | C16H16ClNO9 |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [(3S,5S,6S)-4-acetyloxy-3-(2-chloro-4-nitrophenoxy)-2,7-dioxabicyclo[4.2.0]octan-5-yl] acetate |
| SMILES | CC(=O)OC1[C@H](Oc2ccc([N+](=O)[O-])cc2Cl)OC2CO[C@@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H16ClNO9/c1-7(19)24-14-13-12(6-23-13)27-16(15(14)25-8(2)20)26-11-4-3-9(18(21)22)5-10(11)17/h3-5,12-16H,6H2,1-2H3/t12?,13-,14-,15?,16+/m0/s1 |
| InChIKey | ZUHYDHLWLUEECE-BEBHXBEKSA-N |
| XLogP | 1.61 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|