C14H14ClNO7 — CID 126646568
2-[(3S,3aR,6S,6aR)-6-(2-chloro-4-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid (PubChem CID 126646568) has the molecular formula C14H14ClNO7 and a molecular weight of 343.72 g/mol. Its IUPAC name is 2-[(3S,3aR,6S,6aR)-6-(2-chloro-4-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid.
| Compound Name | 2-[(3S,3aR,6S,6aR)-6-(2-chloro-4-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid |
|---|---|
| PubChem CID | 126646568 |
| Molecular Formula | C14H14ClNO7 |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-[(3S,3aR,6S,6aR)-6-(2-chloro-4-nitrophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2Oc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H14ClNO7/c15-9-4-8(16(19)20)1-2-10(9)23-11-6-22-13-7(3-12(17)18)5-21-14(11)13/h1-2,4,7,11,13-14H,3,5-6H2,(H,17,18)/t7-,11-,13+,14-/m0/s1 |
| InChIKey | HDHMQCOXMBKELS-YGKMZZGGSA-N |
| XLogP | 1.88 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|