C12H14ClNO8 — CID 71182093
(2S,4S,5S)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71182093) has the molecular formula C12H14ClNO8 and a molecular weight of 335.70 g/mol. Its IUPAC name is (2S,4S,5S)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,4S,5S)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71182093 |
| Molecular Formula | C12H14ClNO8 |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (2S,4S,5S)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClNO8/c13-6-3-5(14(19)20)1-2-7(6)21-12-11(18)10(17)9(16)8(4-15)22-12/h1-3,8-12,15-18H,4H2/t8?,9-,10+,11?,12-/m1/s1 |
| InChIKey | PJCVBKZRKNFZOD-RXUZKVILSA-N |
| XLogP | -0.57 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|