C12H12ClNO7S — CID 89314408
(2S,3S,4S,5R,6S)-6-(2-chloro-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carbothialdehyde (PubChem CID 89314408) has the molecular formula C12H12ClNO7S and a molecular weight of 349.75 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-(2-chloro-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carbothialdehyde.
| Compound Name | (2S,3S,4S,5R,6S)-6-(2-chloro-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carbothialdehyde |
|---|---|
| PubChem CID | 89314408 |
| Molecular Formula | C12H12ClNO7S |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-(2-chloro-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carbothialdehyde |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2O[C@H](C=S)[C@@H](O)[C@H](O)[C@H]2O)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClNO7S/c13-6-3-5(14(18)19)1-2-7(6)20-12-11(17)10(16)9(15)8(4-22)21-12/h1-4,8-12,15-17H/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | NOYWFECOXPWJQT-RMPHRYRLSA-N |
| XLogP | 0.43 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|