C12H13ClN4O7 — CID 126673257
(2R,3R,4R,5R)-5-azido-6-(2-chloro-4-nitrophenoxy)-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 126673257) has the molecular formula C12H13ClN4O7 and a molecular weight of 360.71 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-azido-6-(2-chloro-4-nitrophenoxy)-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-azido-6-(2-chloro-4-nitrophenoxy)-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 126673257 |
| Molecular Formula | C12H13ClN4O7 |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (2R,3R,4R,5R)-5-azido-6-(2-chloro-4-nitrophenoxy)-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@H]1C(Oc2ccc([N+](=O)[O-])cc2Cl)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H13ClN4O7/c13-6-3-5(17(21)22)1-2-7(6)23-12-9(15-16-14)11(20)10(19)8(4-18)24-12/h1-3,8-12,18-20H,4H2/t8-,9-,10+,11-,12?/m1/s1 |
| InChIKey | BJMHBPGJICQXPT-OZRWLHRGSA-N |
| XLogP | 0.74 |
| TPSA | 171.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|