C12H13Cl2NO8 — CID 18651653
(2S,3R,4S,5S,6R)-2-(2,6-dichloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 18651653) has the molecular formula C12H13Cl2NO8 and a molecular weight of 370.14 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(2,6-dichloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(2,6-dichloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 18651653 |
| Molecular Formula | C12H13Cl2NO8 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(2,6-dichloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO8/c13-5-1-4(15(20)21)2-6(14)11(5)23-12-10(19)9(18)8(17)7(3-16)22-12/h1-2,7-10,12,16-19H,3H2/t7-,8-,9+,10-,12+/m1/s1 |
| InChIKey | BJUJHKQUMHZZJW-GPTQDWHKSA-N |
| XLogP | 0.08 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|