C12H15Cl2NO6 — CID 22941387
(2S,3S,4S,5S,6R)-2-(4-amino-2,6-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 22941387) has the molecular formula C12H15Cl2NO6 and a molecular weight of 340.16 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-(4-amino-2,6-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6R)-2-(4-amino-2,6-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 22941387 |
| Molecular Formula | C12H15Cl2NO6 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-(4-amino-2,6-dichlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1cc(Cl)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO6/c13-5-1-4(15)2-6(14)11(5)21-12-10(19)9(18)8(17)7(3-16)20-12/h1-2,7-10,12,16-19H,3,15H2/t7-,8-,9+,10+,12+/m1/s1 |
| InChIKey | MLPXCAOJFFLAOV-RWHSBRQSSA-N |
| XLogP | -0.25 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|