C20H20Cl2O8 — CID 70933925
methyl 4-[3,5-dichloro-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate (PubChem CID 70933925) has the molecular formula C20H20Cl2O8 and a molecular weight of 459.28 g/mol. Its IUPAC name is methyl 4-[3,5-dichloro-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate.
| Compound Name | methyl 4-[3,5-dichloro-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 70933925 |
| Molecular Formula | C20H20Cl2O8 |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | methyl 4-[3,5-dichloro-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(Cl)c(O[C@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H20Cl2O8/c1-28-19(27)10-4-2-9(3-5-10)11-6-12(21)18(13(22)7-11)30-20-17(26)16(25)15(24)14(8-23)29-20/h2-7,14-17,20,23-26H,8H2,1H3/t14?,15-,16+,17?,20-/m1/s1 |
| InChIKey | LGMPJLJIHTWSMR-FRGPVAJHSA-N |
| XLogP | 1.63 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |