C20H22ClNO7 — CID 71074061
3-[3-chloro-4-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-N-methylbenzamide (PubChem CID 71074061) has the molecular formula C20H22ClNO7 and a molecular weight of 423.85 g/mol. Its IUPAC name is 3-[3-chloro-4-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-N-methylbenzamide.
| Compound Name | 3-[3-chloro-4-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 71074061 |
| Molecular Formula | C20H22ClNO7 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 3-[3-chloro-4-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc(OC3O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]3O)c(Cl)c2)c1 |
| InChI | InChI=1S/C20H22ClNO7/c1-22-19(27)12-4-2-3-10(7-12)11-5-6-14(13(21)8-11)28-20-18(26)17(25)16(24)15(9-23)29-20/h2-8,15-18,20,23-26H,9H2,1H3,(H,22,27)/t15-,16+,17+,18-,20?/m0/s1 |
| InChIKey | DUCIZBPRHAYUHV-RXTJHEEISA-N |
| XLogP | 0.55 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |