C21H21F3O8 — CID 71074578
methyl 3-[3-(trifluoromethyl)-4-[(3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate (PubChem CID 71074578) has the molecular formula C21H21F3O8 and a molecular weight of 458.39 g/mol. Its IUPAC name is methyl 3-[3-(trifluoromethyl)-4-[(3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate.
| Compound Name | methyl 3-[3-(trifluoromethyl)-4-[(3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 71074578 |
| Molecular Formula | C21H21F3O8 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | methyl 3-[3-(trifluoromethyl)-4-[(3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(OC3O[C@@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H21F3O8/c1-30-19(29)12-4-2-3-10(7-12)11-5-6-14(13(8-11)21(22,23)24)31-20-18(28)17(27)16(26)15(9-25)32-20/h2-8,15-18,20,25-28H,9H2,1H3/t15-,16+,17-,18+,20?/m0/s1 |
| InChIKey | PEXUOFDLMMYTPD-BSNRQGGHSA-N |
| XLogP | 1.34 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |