C20H23NO8 — CID 130455356
methyl 5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyridine-3-carboxylate (PubChem CID 130455356) has the molecular formula C20H23NO8 and a molecular weight of 405.40 g/mol. Its IUPAC name is methyl 5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyridine-3-carboxylate.
| Compound Name | methyl 5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130455356 |
| Molecular Formula | C20H23NO8 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | methyl 5-[3-methyl-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(C)c2)c1 |
| InChI | InChI=1S/C20H23NO8/c1-10-5-11(12-6-13(8-21-7-12)19(26)27-2)3-4-14(10)28-20-18(25)17(24)16(23)15(9-22)29-20/h3-8,15-18,20,22-25H,9H2,1-2H3/t15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | WWZAJMUDBKQTLG-JGLNRKDHSA-N |
| XLogP | 0.02 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |