C18H19F3N2O6 — CID 164835828
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-methyl-4-[6-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol (PubChem CID 164835828) has the molecular formula C18H19F3N2O6 and a molecular weight of 416.35 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-methyl-4-[6-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-methyl-4-[6-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 164835828 |
| Molecular Formula | C18H19F3N2O6 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-methyl-4-[6-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol |
| SMILES | Cc1cc(-c2cncc(C(F)(F)F)n2)ccc1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19F3N2O6/c1-8-4-9(10-5-22-6-13(23-10)18(19,20)21)2-3-11(8)28-17-16(27)15(26)14(25)12(7-24)29-17/h2-6,12,14-17,24-27H,7H2,1H3/t12-,14-,15+,16+,17+/m1/s1 |
| InChIKey | QOLAOKWUCBFNTR-ZUOZUFPHSA-N |
| XLogP | 0.65 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |