C20H25NO8 — CID 163443034
2-[4-[5-[hydroxy(methoxy)methyl]-3-pyridinyl]-2-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163443034) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-[4-[5-[hydroxy(methoxy)methyl]-3-pyridinyl]-2-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[4-[5-[hydroxy(methoxy)methyl]-3-pyridinyl]-2-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163443034 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[4-[5-[hydroxy(methoxy)methyl]-3-pyridinyl]-2-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COC(O)c1cncc(-c2ccc(OC3OC(CO)C(O)C(O)C3O)c(C)c2)c1 |
| InChI | InChI=1S/C20H25NO8/c1-10-5-11(12-6-13(8-21-7-12)19(26)27-2)3-4-14(10)28-20-18(25)17(24)16(23)15(9-22)29-20/h3-8,15-20,22-26H,9H2,1-2H3 |
| InChIKey | BAEKGMCDVYBVIL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|