C18H16F6N2O6 — CID 155412739
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[5-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol (PubChem CID 155412739) has the molecular formula C18H16F6N2O6 and a molecular weight of 470.32 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[5-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[5-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 155412739 |
| Molecular Formula | C18H16F6N2O6 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[5-(trifluoromethyl)pyrazin-2-yl]phenoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(-c3cnc(C(F)(F)F)cn3)cc2C(F)(F)F)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H16F6N2O6/c19-17(20,21)8-3-7(9-4-26-12(5-25-9)18(22,23)24)1-2-10(8)31-16-15(30)14(29)13(28)11(6-27)32-16/h1-5,11,13-16,27-30H,6H2/t11-,13-,14+,15+,16+/m1/s1 |
| InChIKey | HIMILBMYCBNYKA-VMMWWAARSA-N |
| XLogP | 1.36 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |