C12H14F3NO6 — CID 138394701
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4,5-triol (PubChem CID 138394701) has the molecular formula C12H14F3NO6 and a molecular weight of 325.24 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 138394701 |
| Molecular Formula | C12H14F3NO6 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2cccc(C(F)(F)F)n2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14F3NO6/c13-12(14,15)6-2-1-3-7(16-6)22-11-10(20)9(19)8(18)5(4-17)21-11/h1-3,5,8-11,17-20H,4H2/t5-,8-,9+,10-,11-/m1/s1 |
| InChIKey | UVRKKNJHGSZJBT-HDYLDQSBSA-N |
| XLogP | -0.72 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |