C19H19F3O6 — CID 46838629
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-[3-(trifluoromethyl)phenyl]phenoxy]oxane-3,4,5-triol (PubChem CID 46838629) has the molecular formula C19H19F3O6 and a molecular weight of 400.35 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-[3-(trifluoromethyl)phenyl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-[3-(trifluoromethyl)phenyl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46838629 |
| Molecular Formula | C19H19F3O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-[3-(trifluoromethyl)phenyl]phenoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(-c3cccc(C(F)(F)F)c3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H19F3O6/c20-19(21,22)12-3-1-2-11(8-12)10-4-6-13(7-5-10)27-18-17(26)16(25)15(24)14(9-23)28-18/h1-8,14-18,23-26H,9H2/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | VOKDUSSLFSGJJL-ZBRFXRBCSA-N |
| XLogP | 1.55 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |