C18H20O7 — CID 46838355
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(4-hydroxyphenyl)phenoxy]oxane-3,4,5-triol (PubChem CID 46838355) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(4-hydroxyphenyl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(4-hydroxyphenyl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46838355 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[4-(4-hydroxyphenyl)phenoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(-c3ccc(O)cc3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20O7/c19-9-14-15(21)16(22)17(23)18(25-14)24-13-7-3-11(4-8-13)10-1-5-12(20)6-2-10/h1-8,14-23H,9H2/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | WLRIBKNNILLRLG-ZBRFXRBCSA-N |
| XLogP | 0.24 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |